C18H19N3OS2 — CID 7753952
5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 7753952) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 7753952 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(2-methylphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cccc(OCCSc2nnc(Nc3ccccc3C)s2)c1 |
| InChI | InChI=1S/C18H19N3OS2/c1-13-6-5-8-15(12-13)22-10-11-23-18-21-20-17(24-18)19-16-9-4-3-7-14(16)2/h3-9,12H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | OCUCYRACUGNTHO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|