C16H21N3O2S2 — CID 46639720
5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 46639720) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 46639720 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-[2-(3-methylphenoxy)ethylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cccc(OCCSc2nnc(NCC3CCCO3)s2)c1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-12-4-2-5-13(10-12)21-8-9-22-16-19-18-15(23-16)17-11-14-6-3-7-20-14/h2,4-5,10,14H,3,6-9,11H2,1H3,(H,17,18) |
| InChIKey | UFYMLZMLENMVSZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|