C17H20N4O2S2 — CID 47059796
5-[3-(1,3-benzoxazol-2-yl)propylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 47059796) has the molecular formula C17H20N4O2S2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 5-[3-(1,3-benzoxazol-2-yl)propylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3-(1,3-benzoxazol-2-yl)propylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 47059796 |
| Molecular Formula | C17H20N4O2S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 5-[3-(1,3-benzoxazol-2-yl)propylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc2oc(CCCSc3nnc(NCC4CCCO4)s3)nc2c1 |
| InChI | InChI=1S/C17H20N4O2S2/c1-2-7-14-13(6-1)19-15(23-14)8-4-10-24-17-21-20-16(25-17)18-11-12-5-3-9-22-12/h1-2,6-7,12H,3-5,8-11H2,(H,18,20) |
| InChIKey | QYWCMWBBCHVGGH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|