C13H15ClN4OS2 — CID 134012423
5-[(6-chloro-3-pyridinyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 134012423) has the molecular formula C13H15ClN4OS2 and a molecular weight of 342.88 g/mol. Its IUPAC name is 5-[(6-chloro-3-pyridinyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(6-chloro-3-pyridinyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 134012423 |
| Molecular Formula | C13H15ClN4OS2 |
| Molecular Weight | 342.88 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 5-[(6-chloro-3-pyridinyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Clc1ccc(CSc2nnc(NCC3CCCO3)s2)cn1 |
| InChI | InChI=1S/C13H15ClN4OS2/c14-11-4-3-9(6-15-11)8-20-13-18-17-12(21-13)16-7-10-2-1-5-19-10/h3-4,6,10H,1-2,5,7-8H2,(H,16,17) |
| InChIKey | HVNFKJOPCWFWDC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|