C11H14N4OS2 — CID 71848210
4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]but-2-enenitrile (PubChem CID 71848210) has the molecular formula C11H14N4OS2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]but-2-enenitrile.
| Compound Name | 4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 71848210 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]but-2-enenitrile |
| SMILES | N#CC=CCSc1nnc(NCC2CCCO2)s1 |
| InChI | InChI=1S/C11H14N4OS2/c12-5-1-2-7-17-11-15-14-10(18-11)13-8-9-4-3-6-16-9/h1-2,9H,3-4,6-8H2,(H,13,14) |
| InChIKey | GQYOESJGWBWCJR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|