C19H16N4O2S2 — CID 3485548
2-[2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 3485548) has the molecular formula C19H16N4O2S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-[2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3485548 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-[2-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccccc1Nc1nnc(SCCN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C19H16N4O2S2/c1-12-6-2-5-9-15(12)20-18-21-22-19(27-18)26-11-10-23-16(24)13-7-3-4-8-14(13)17(23)25/h2-9H,10-11H2,1H3,(H,20,21) |
| InChIKey | CSHZWKYSPNYPHS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|