C13H20N4SSi — CID 56529201
[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl-trimethylsilane (PubChem CID 56529201) has the molecular formula C13H20N4SSi and a molecular weight of 292.48 g/mol. Its IUPAC name is [1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl-trimethylsilane.
| Compound Name | [1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl-trimethylsilane |
|---|---|
| PubChem CID | 56529201 |
| Molecular Formula | C13H20N4SSi |
| Molecular Weight | 292.48 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl-trimethylsilane |
| SMILES | Cc1cccc(-n2nnnc2SC[Si](C)(C)C)c1C |
| InChI | InChI=1S/C13H20N4SSi/c1-10-7-6-8-12(11(10)2)17-13(14-15-16-17)18-9-19(3,4)5/h6-8H,9H2,1-5H3 |
| InChIKey | BYNFUKDYFHADML-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|