C10H12N4S — CID 60519571
1-(2,3-dimethylphenyl)-5-methylsulfanyltetrazole (PubChem CID 60519571) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-5-methylsulfanyltetrazole.
| Compound Name | 1-(2,3-dimethylphenyl)-5-methylsulfanyltetrazole |
|---|---|
| PubChem CID | 60519571 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-5-methylsulfanyltetrazole |
| SMILES | CSc1nnnn1-c1cccc(C)c1C |
| InChI | InChI=1S/C10H12N4S/c1-7-5-4-6-9(8(7)2)14-10(15-3)11-12-13-14/h4-6H,1-3H3 |
| InChIKey | CLVRKDZSFHLOPJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |