C17H18N4S — CID 8798481
1-(2,3-dimethylphenyl)-5-[(1R)-1-phenylethyl]sulfanyltetrazole (PubChem CID 8798481) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-5-[(1R)-1-phenylethyl]sulfanyltetrazole.
| Compound Name | 1-(2,3-dimethylphenyl)-5-[(1R)-1-phenylethyl]sulfanyltetrazole |
|---|---|
| PubChem CID | 8798481 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-5-[(1R)-1-phenylethyl]sulfanyltetrazole |
| SMILES | Cc1cccc(-n2nnnc2S[C@H](C)c2ccccc2)c1C |
| InChI | InChI=1S/C17H18N4S/c1-12-8-7-11-16(13(12)2)21-17(18-19-20-21)22-14(3)15-9-5-4-6-10-15/h4-11,14H,1-3H3/t14-/m1/s1 |
| InChIKey | LHLAMAMQYXQNMK-CQSZACIVSA-N |
| XLogP | 4.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |