C13H13F3N4O3S — CID 28916365
4-[3-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid (PubChem CID 28916365) has the molecular formula C13H13F3N4O3S and a molecular weight of 362.33 g/mol. Its IUPAC name is 4-[3-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid.
| Compound Name | 4-[3-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 28916365 |
| Molecular Formula | C13H13F3N4O3S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-[3-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid |
| SMILES | Nn1c(SCCCOc2ccc(C(=O)O)cc2)nnc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3N4O3S/c14-13(15,16)11-18-19-12(20(11)17)24-7-1-6-23-9-4-2-8(3-5-9)10(21)22/h2-5H,1,6-7,17H2,(H,21,22) |
| InChIKey | CNPMLIPAWAAAFI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|