C13H14N4O4S — CID 28916267
4-[3-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]propoxy]benzoic acid (PubChem CID 28916267) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is 4-[3-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]propoxy]benzoic acid.
| Compound Name | 4-[3-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 28916267 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-[3-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]propoxy]benzoic acid |
| SMILES | Nn1c(SCCCOc2ccc(C(=O)O)cc2)nncc1=O |
| InChI | InChI=1S/C13H14N4O4S/c14-17-11(18)8-15-16-13(17)22-7-1-6-21-10-4-2-9(3-5-10)12(19)20/h2-5,8H,1,6-7,14H2,(H,19,20) |
| InChIKey | NALOBXWQFLAVCD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|