C16H22N4O3S2 — CID 28916363
4-[3-[[4-amino-5-(propylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid (PubChem CID 28916363) has the molecular formula C16H22N4O3S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-[3-[[4-amino-5-(propylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid.
| Compound Name | 4-[3-[[4-amino-5-(propylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 28916363 |
| Molecular Formula | C16H22N4O3S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[3-[[4-amino-5-(propylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzoic acid |
| SMILES | CCCSCc1nnc(SCCCOc2ccc(C(=O)O)cc2)n1N |
| InChI | InChI=1S/C16H22N4O3S2/c1-2-9-24-11-14-18-19-16(20(14)17)25-10-3-8-23-13-6-4-12(5-7-13)15(21)22/h4-7H,2-3,8-11,17H2,1H3,(H,21,22) |
| InChIKey | ITFTUMMWERNOBB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|