C6H11N5OS — CID 28915719
4-amino-3-(3-aminopropylsulfanyl)-1,2,4-triazin-5-one (PubChem CID 28915719) has the molecular formula C6H11N5OS and a molecular weight of 201.25 g/mol. Its IUPAC name is 4-amino-3-(3-aminopropylsulfanyl)-1,2,4-triazin-5-one.
| Compound Name | 4-amino-3-(3-aminopropylsulfanyl)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 28915719 |
| Molecular Formula | C6H11N5OS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 4-amino-3-(3-aminopropylsulfanyl)-1,2,4-triazin-5-one |
| SMILES | NCCCSc1nncc(=O)n1N |
| InChI | InChI=1S/C6H11N5OS/c7-2-1-3-13-6-10-9-4-5(12)11(6)8/h4H,1-3,7-8H2 |
| InChIKey | RDUIFKAHRVKLGU-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|