C11H10IN5O2S — CID 39757476
2-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide (PubChem CID 39757476) has the molecular formula C11H10IN5O2S and a molecular weight of 403.21 g/mol. Its IUPAC name is 2-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 39757476 |
| Molecular Formula | C11H10IN5O2S |
| Molecular Weight | 403.21 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | 2-[(4-amino-5-oxo-1,2,4-triazin-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide |
| SMILES | Nn1c(SCC(=O)Nc2ccc(I)cc2)nncc1=O |
| InChI | InChI=1S/C11H10IN5O2S/c12-7-1-3-8(4-2-7)15-9(18)6-20-11-16-14-5-10(19)17(11)13/h1-5H,6,13H2,(H,15,18) |
| InChIKey | DECMAQJBKDCCDT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|