C19H20IN5OS — CID 5021712
2-[[4-amino-5-(2-phenylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide (PubChem CID 5021712) has the molecular formula C19H20IN5OS and a molecular weight of 493.37 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-phenylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2-phenylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 5021712 |
| Molecular Formula | C19H20IN5OS |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 2-[[4-amino-5-(2-phenylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide |
| SMILES | CC(Cc1nnc(SCC(=O)Nc2ccc(I)cc2)n1N)c1ccccc1 |
| InChI | InChI=1S/C19H20IN5OS/c1-13(14-5-3-2-4-6-14)11-17-23-24-19(25(17)21)27-12-18(26)22-16-9-7-15(20)8-10-16/h2-10,13H,11-12,21H2,1H3,(H,22,26) |
| InChIKey | RZZNGOKWZFIOIZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|