C9H19N5S — CID 28915797
3-(3-aminopropylsulfanyl)-5-butyl-1,2,4-triazol-4-amine (PubChem CID 28915797) has the molecular formula C9H19N5S and a molecular weight of 229.35 g/mol. Its IUPAC name is 3-(3-aminopropylsulfanyl)-5-butyl-1,2,4-triazol-4-amine.
| Compound Name | 3-(3-aminopropylsulfanyl)-5-butyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 28915797 |
| Molecular Formula | C9H19N5S |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 3-(3-aminopropylsulfanyl)-5-butyl-1,2,4-triazol-4-amine |
| SMILES | CCCCc1nnc(SCCCN)n1N |
| InChI | InChI=1S/C9H19N5S/c1-2-3-5-8-12-13-9(14(8)11)15-7-4-6-10/h2-7,10-11H2,1H3 |
| InChIKey | SAXRAKNHTWSXMF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|