C9H19N5S2 — CID 28915821
3-(3-aminopropylsulfanyl)-5-(propan-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine (PubChem CID 28915821) has the molecular formula C9H19N5S2 and a molecular weight of 261.42 g/mol. Its IUPAC name is 3-(3-aminopropylsulfanyl)-5-(propan-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-(3-aminopropylsulfanyl)-5-(propan-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 28915821 |
| Molecular Formula | C9H19N5S2 |
| Molecular Weight | 261.42 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-(3-aminopropylsulfanyl)-5-(propan-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine |
| SMILES | CC(C)SCc1nnc(SCCCN)n1N |
| InChI | InChI=1S/C9H19N5S2/c1-7(2)16-6-8-12-13-9(14(8)11)15-5-3-4-10/h7H,3-6,10-11H2,1-2H3 |
| InChIKey | PRKMCSMYFIQKFC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|