C13H19N5S — CID 28915638
3-[(4-aminophenyl)methylsulfanyl]-5-(2-methylpropyl)-1,2,4-triazol-4-amine (PubChem CID 28915638) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methylsulfanyl]-5-(2-methylpropyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[(4-aminophenyl)methylsulfanyl]-5-(2-methylpropyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 28915638 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-[(4-aminophenyl)methylsulfanyl]-5-(2-methylpropyl)-1,2,4-triazol-4-amine |
| SMILES | CC(C)Cc1nnc(SCc2ccc(N)cc2)n1N |
| InChI | InChI=1S/C13H19N5S/c1-9(2)7-12-16-17-13(18(12)15)19-8-10-3-5-11(14)6-4-10/h3-6,9H,7-8,14-15H2,1-2H3 |
| InChIKey | MALOEBWMNIAUIO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|