C11H14BrN5S — CID 95910906
3-[(4-amino-2-bromophenyl)methylsulfanyl]-5-ethyl-1,2,4-triazol-4-amine (PubChem CID 95910906) has the molecular formula C11H14BrN5S and a molecular weight of 328.24 g/mol. Its IUPAC name is 3-[(4-amino-2-bromophenyl)methylsulfanyl]-5-ethyl-1,2,4-triazol-4-amine.
| Compound Name | 3-[(4-amino-2-bromophenyl)methylsulfanyl]-5-ethyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 95910906 |
| Molecular Formula | C11H14BrN5S |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 3-[(4-amino-2-bromophenyl)methylsulfanyl]-5-ethyl-1,2,4-triazol-4-amine |
| SMILES | CCc1nnc(SCc2ccc(N)cc2Br)n1N |
| InChI | InChI=1S/C11H14BrN5S/c1-2-10-15-16-11(17(10)14)18-6-7-3-4-8(13)5-9(7)12/h3-5H,2,6,13-14H2,1H3 |
| InChIKey | LWQCANHGJLRNAB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|