C11H15N5OS — CID 56772700
3-(4-amino-2-methoxyphenyl)sulfanyl-5-ethyl-1,2,4-triazol-4-amine (PubChem CID 56772700) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-(4-amino-2-methoxyphenyl)sulfanyl-5-ethyl-1,2,4-triazol-4-amine.
| Compound Name | 3-(4-amino-2-methoxyphenyl)sulfanyl-5-ethyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 56772700 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-(4-amino-2-methoxyphenyl)sulfanyl-5-ethyl-1,2,4-triazol-4-amine |
| SMILES | CCc1nnc(Sc2ccc(N)cc2OC)n1N |
| InChI | InChI=1S/C11H15N5OS/c1-3-10-14-15-11(16(10)13)18-9-5-4-7(12)6-8(9)17-2/h4-6H,3,12-13H2,1-2H3 |
| InChIKey | QGYIXKZAIMJVCW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|