C10H9BrN2S2 — CID 61220458
3-bromo-4-(1,3-thiazol-2-ylsulfanylmethyl)aniline (PubChem CID 61220458) has the molecular formula C10H9BrN2S2 and a molecular weight of 301.23 g/mol. Its IUPAC name is 3-bromo-4-(1,3-thiazol-2-ylsulfanylmethyl)aniline.
| Compound Name | 3-bromo-4-(1,3-thiazol-2-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 61220458 |
| Molecular Formula | C10H9BrN2S2 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 3-bromo-4-(1,3-thiazol-2-ylsulfanylmethyl)aniline |
| SMILES | Nc1ccc(CSc2nccs2)c(Br)c1 |
| InChI | InChI=1S/C10H9BrN2S2/c11-9-5-8(12)2-1-7(9)6-15-10-13-3-4-14-10/h1-5H,6,12H2 |
| InChIKey | KLLYLSXABRFYFZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|