C11H11FN2S2 — CID 63289568
[5-fluoro-2-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]methanamine (PubChem CID 63289568) has the molecular formula C11H11FN2S2 and a molecular weight of 254.36 g/mol. Its IUPAC name is [5-fluoro-2-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]methanamine.
| Compound Name | [5-fluoro-2-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 63289568 |
| Molecular Formula | C11H11FN2S2 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | [5-fluoro-2-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]methanamine |
| SMILES | NCc1cc(F)ccc1CSc1nccs1 |
| InChI | InChI=1S/C11H11FN2S2/c12-10-2-1-8(9(5-10)6-13)7-16-11-14-3-4-15-11/h1-5H,6-7,13H2 |
| InChIKey | PDBZQGJHDBZRAT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|