C13H11FN2S2 — CID 54969826
3-[3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine (PubChem CID 54969826) has the molecular formula C13H11FN2S2 and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-[3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 54969826 |
| Molecular Formula | C13H11FN2S2 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-[3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(CSc2nccs2)c(F)c1 |
| InChI | InChI=1S/C13H11FN2S2/c14-12-8-10(2-1-5-15)3-4-11(12)9-18-13-16-6-7-17-13/h3-4,6-8H,5,9,15H2 |
| InChIKey | YSYNRCJKBVRHBH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|