C11H12N2OS2 — CID 61218917
2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)aniline (PubChem CID 61218917) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)aniline.
| Compound Name | 2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 61218917 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)aniline |
| SMILES | COc1ccc(CSc2nccs2)cc1N |
| InChI | InChI=1S/C11H12N2OS2/c1-14-10-3-2-8(6-9(10)12)7-16-11-13-4-5-15-11/h2-6H,7,12H2,1H3 |
| InChIKey | UFXPTAIMFJIRJL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|