C12H10N2OS2 — CID 65341846
2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile (PubChem CID 65341846) has the molecular formula C12H10N2OS2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile.
| Compound Name | 2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
|---|---|
| PubChem CID | 65341846 |
| Molecular Formula | C12H10N2OS2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 2-methoxy-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
| SMILES | COc1ccc(CSc2nccs2)cc1C#N |
| InChI | InChI=1S/C12H10N2OS2/c1-15-11-3-2-9(6-10(11)7-13)8-17-12-14-4-5-16-12/h2-6H,8H2,1H3 |
| InChIKey | SBNRNMFAOCLBBY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|