C16H12N2OS2 — CID 65341795
5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-methoxybenzonitrile (PubChem CID 65341795) has the molecular formula C16H12N2OS2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-methoxybenzonitrile.
| Compound Name | 5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 65341795 |
| Molecular Formula | C16H12N2OS2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-methoxybenzonitrile |
| SMILES | COc1ccc(CSc2nc3ccccc3s2)cc1C#N |
| InChI | InChI=1S/C16H12N2OS2/c1-19-14-7-6-11(8-12(14)9-17)10-20-16-18-13-4-2-3-5-15(13)21-16/h2-8H,10H2,1H3 |
| InChIKey | JLNUOHQBEVEPTM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |