C11H7FN2S2 — CID 103758889
2-fluoro-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile (PubChem CID 103758889) has the molecular formula C11H7FN2S2 and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-fluoro-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile.
| Compound Name | 2-fluoro-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
|---|---|
| PubChem CID | 103758889 |
| Molecular Formula | C11H7FN2S2 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-fluoro-5-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
| SMILES | N#Cc1cc(CSc2nccs2)ccc1F |
| InChI | InChI=1S/C11H7FN2S2/c12-10-2-1-8(5-9(10)6-13)7-16-11-14-3-4-15-11/h1-5H,7H2 |
| InChIKey | MZKDGVOHNKYMBH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|