C12H8FN3OS — CID 114012409
2-fluoro-5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile (PubChem CID 114012409) has the molecular formula C12H8FN3OS and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-fluoro-5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 114012409 |
| Molecular Formula | C12H8FN3OS |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-fluoro-5-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzonitrile |
| SMILES | N#Cc1cc(CSc2nccc(=O)[nH]2)ccc1F |
| InChI | InChI=1S/C12H8FN3OS/c13-10-2-1-8(5-9(10)6-14)7-18-12-15-4-3-11(17)16-12/h1-5H,7H2,(H,15,16,17) |
| InChIKey | NPKPOYWVMJQNCI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |