C12H9FN2O3S — CID 106698582
2-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzoic acid (PubChem CID 106698582) has the molecular formula C12H9FN2O3S and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzoic acid.
| Compound Name | 2-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 106698582 |
| Molecular Formula | C12H9FN2O3S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-fluoro-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CSc2nccc(=O)[nH]2)cc1F |
| InChI | InChI=1S/C12H9FN2O3S/c13-9-5-7(1-2-8(9)11(17)18)6-19-12-14-4-3-10(16)15-12/h1-5H,6H2,(H,17,18)(H,14,15,16) |
| InChIKey | OQCHXFARJDFTRH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |