C11H8FNO2S2 — CID 106698607
2-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid (PubChem CID 106698607) has the molecular formula C11H8FNO2S2 and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid.
| Compound Name | 2-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 106698607 |
| Molecular Formula | C11H8FNO2S2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 2-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CSc2nccs2)cc1F |
| InChI | InChI=1S/C11H8FNO2S2/c12-9-5-7(1-2-8(9)10(14)15)6-17-11-13-3-4-16-11/h1-5H,6H2,(H,14,15) |
| InChIKey | JVPJHUFMLUWCHK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|