C8H6N2O3S2 — CID 61397335
5-(1,3-thiazol-2-ylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 61397335) has the molecular formula C8H6N2O3S2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-ylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(1,3-thiazol-2-ylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 61397335 |
| Molecular Formula | C8H6N2O3S2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 5-(1,3-thiazol-2-ylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CSc2nccs2)on1 |
| InChI | InChI=1S/C8H6N2O3S2/c11-7(12)6-3-5(13-10-6)4-15-8-9-1-2-14-8/h1-3H,4H2,(H,11,12) |
| InChIKey | HANXINBFQISWLQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|