C7H9NO4S — CID 61397277
5-(2-hydroxyethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 61397277) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is 5-(2-hydroxyethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(2-hydroxyethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 61397277 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 5-(2-hydroxyethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CSCCO)on1 |
| InChI | InChI=1S/C7H9NO4S/c9-1-2-13-4-5-3-6(7(10)11)8-12-5/h3,9H,1-2,4H2,(H,10,11) |
| InChIKey | BXLDBQYNYATTLX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|