C7H10N2O4 — CID 103238258
5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 103238258) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 103238258 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CNCCO)on1 |
| InChI | InChI=1S/C7H10N2O4/c10-2-1-8-4-5-3-6(7(11)12)9-13-5/h3,8,10H,1-2,4H2,(H,11,12) |
| InChIKey | DBYCIRQFXLWJEH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|