5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid

C7H10N2O4 — CID 103238258

IUPAC5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(CNCCO)on1
InChIInChI=1S/C7H10N2O4/c10-2-1-8-4-5-3-6(7(11)12)9-13-5/h3,8,10H,1-2,4H2,(H,11,12)
InChIKeyDBYCIRQFXLWJEH-UHFFFAOYSA-N
MW186.17 g/mol
LogP-0.55
Rot. Bonds5

About 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid

5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 103238258) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid
PubChem CID103238258
Molecular FormulaC7H10N2O4
Molecular Weight186.17 g/mol
Exact Mass186.06
IUPAC Name5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(CNCCO)on1
InChIInChI=1S/C7H10N2O4/c10-2-1-8-4-5-3-6(7(11)12)9-13-5/h3,8,10H,1-2,4H2,(H,11,12)
InChIKeyDBYCIRQFXLWJEH-UHFFFAOYSA-N
XLogP-0.55
TPSA95.59 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.17
LogP ≤ 5-0.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid (CID 103238258) is 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(CNCCO)on1.
What is the InChIKey of 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is DBYCIRQFXLWJEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c10-2-1-8-4-5-3-6(7(11)12)9-13-5/h3,8,10H,1-2,4H2,(H,11,12).
What are the key properties of 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 186.17 g/mol, XLogP of -0.55, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-hydroxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 103238258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).