C13H20N2O4 — CID 103251678
5-[(2-cyclohexyloxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 103251678) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 5-[(2-cyclohexyloxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(2-cyclohexyloxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 103251678 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 5-[(2-cyclohexyloxyethylamino)methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CNCCOC2CCCCC2)on1 |
| InChI | InChI=1S/C13H20N2O4/c16-13(17)12-8-11(19-15-12)9-14-6-7-18-10-4-2-1-3-5-10/h8,10,14H,1-7,9H2,(H,16,17) |
| InChIKey | RADYHJBFWYLYIK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|