C8H12N4O4 — CID 103262446
5-[[2-(carbamoylamino)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 103262446) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is 5-[[2-(carbamoylamino)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[[2-(carbamoylamino)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 103262446 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 5-[[2-(carbamoylamino)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | NC(=O)NCCNCc1cc(C(=O)O)no1 |
| InChI | InChI=1S/C8H12N4O4/c9-8(15)11-2-1-10-4-5-3-6(7(13)14)12-16-5/h3,10H,1-2,4H2,(H,13,14)(H3,9,11,15) |
| InChIKey | LXTHCJVEHBZULQ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|