C9H13N3O5 — CID 106238420
5-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 106238420) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 5-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 106238420 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 5-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | NC(=O)COCCNCc1cc(C(=O)O)no1 |
| InChI | InChI=1S/C9H13N3O5/c10-8(13)5-16-2-1-11-4-6-3-7(9(14)15)12-17-6/h3,11H,1-2,4-5H2,(H2,10,13)(H,14,15) |
| InChIKey | GTRDQDGTMBLZFS-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|