C10H14N2O5 — CID 106238447
2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]furan-3-carboxylic acid (PubChem CID 106238447) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 106238447 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]furan-3-carboxylic acid |
| SMILES | NC(=O)COCCNCc1occc1C(=O)O |
| InChI | InChI=1S/C10H14N2O5/c11-9(13)6-16-4-2-12-5-8-7(10(14)15)1-3-17-8/h1,3,12H,2,4-6H2,(H2,11,13)(H,14,15) |
| InChIKey | FINIMLVDZUKCRD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|