C11H11NO4 — CID 103235122
2-[(furan-2-ylmethylamino)methyl]furan-3-carboxylic acid (PubChem CID 103235122) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-[(furan-2-ylmethylamino)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[(furan-2-ylmethylamino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 103235122 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[(furan-2-ylmethylamino)methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CNCc1ccco1 |
| InChI | InChI=1S/C11H11NO4/c13-11(14)9-3-5-16-10(9)7-12-6-8-2-1-4-15-8/h1-5,12H,6-7H2,(H,13,14) |
| InChIKey | NIEHZFMDSVESOC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |