C8H11NO4 — CID 103238234
2-[(2-hydroxyethylamino)methyl]furan-3-carboxylic acid (PubChem CID 103238234) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-[(2-hydroxyethylamino)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[(2-hydroxyethylamino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 103238234 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-[(2-hydroxyethylamino)methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CNCCO |
| InChI | InChI=1S/C8H11NO4/c10-3-2-9-5-7-6(8(11)12)1-4-13-7/h1,4,9-10H,2-3,5H2,(H,11,12) |
| InChIKey | OARWZZFMWGWUSZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|