C12H19NO4 — CID 103243030
2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 103243030) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 103243030 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | CC(C)CC(CO)NCc1occc1C(=O)O |
| InChI | InChI=1S/C12H19NO4/c1-8(2)5-9(7-14)13-6-11-10(12(15)16)3-4-17-11/h3-4,8-9,13-14H,5-7H2,1-2H3,(H,15,16) |
| InChIKey | WXCRVZDOGUATNQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |