C11H13N3O3 — CID 103251735
2-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-3-carboxylic acid (PubChem CID 103251735) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 103251735 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[[(1-methylimidazol-2-yl)methylamino]methyl]furan-3-carboxylic acid |
| SMILES | Cn1ccnc1CNCc1occc1C(=O)O |
| InChI | InChI=1S/C11H13N3O3/c1-14-4-3-13-10(14)7-12-6-9-8(11(15)16)2-5-17-9/h2-5,12H,6-7H2,1H3,(H,15,16) |
| InChIKey | SXXQZAFDFXYRSZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |