C14H22N4O — CID 63026364
N-[[3-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]furan-2-yl]methyl]ethanamine (PubChem CID 63026364) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-[[3-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[3-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63026364 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-[[3-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1occc1CN(C)Cc1nccn1C |
| InChI | InChI=1S/C14H22N4O/c1-4-15-9-13-12(5-8-19-13)10-17(2)11-14-16-6-7-18(14)3/h5-8,15H,4,9-11H2,1-3H3 |
| InChIKey | KECUEVPICKIQPU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |