C12H22N2O — CID 62438666
N-[[3-(diethylaminomethyl)furan-2-yl]methyl]ethanamine (PubChem CID 62438666) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[[3-(diethylaminomethyl)furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[3-(diethylaminomethyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62438666 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[[3-(diethylaminomethyl)furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1occc1CN(CC)CC |
| InChI | InChI=1S/C12H22N2O/c1-4-13-9-12-11(7-8-15-12)10-14(5-2)6-3/h7-8,13H,4-6,9-10H2,1-3H3 |
| InChIKey | LYHSYBRVXNFKQG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |