C14H16N2O4S — CID 106238437
3-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 106238437) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106238437 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | NC(=O)COCCNCc1c(C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C14H16N2O4S/c15-12(17)8-20-6-5-16-7-10-9-3-1-2-4-11(9)21-13(10)14(18)19/h1-4,16H,5-8H2,(H2,15,17)(H,18,19) |
| InChIKey | ZJRPMFUDAMHQAW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|