C14H16N2O5 — CID 106238438
2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzofuran-3-carboxylic acid (PubChem CID 106238438) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 106238438 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[[2-(2-amino-2-oxoethoxy)ethylamino]methyl]-1-benzofuran-3-carboxylic acid |
| SMILES | NC(=O)COCCNCc1oc2ccccc2c1C(=O)O |
| InChI | InChI=1S/C14H16N2O5/c15-12(17)8-20-6-5-16-7-11-13(14(18)19)9-3-1-2-4-10(9)21-11/h1-4,16H,5-8H2,(H2,15,17)(H,18,19) |
| InChIKey | WYYCLBWPUHZFIM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|