C14H15NO5 — CID 103245339
2-[[(1-methoxy-1-oxopropan-2-yl)amino]methyl]-1-benzofuran-3-carboxylic acid (PubChem CID 103245339) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[[(1-methoxy-1-oxopropan-2-yl)amino]methyl]-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-[[(1-methoxy-1-oxopropan-2-yl)amino]methyl]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 103245339 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[[(1-methoxy-1-oxopropan-2-yl)amino]methyl]-1-benzofuran-3-carboxylic acid |
| SMILES | COC(=O)C(C)NCc1oc2ccccc2c1C(=O)O |
| InChI | InChI=1S/C14H15NO5/c1-8(14(18)19-2)15-7-11-12(13(16)17)9-5-3-4-6-10(9)20-11/h3-6,8,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | QLUNOKHQLXREOC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |