C13H12F3NO3 — CID 103250348
2-[(3,3,3-trifluoropropylamino)methyl]-1-benzofuran-3-carboxylic acid (PubChem CID 103250348) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-[(3,3,3-trifluoropropylamino)methyl]-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-[(3,3,3-trifluoropropylamino)methyl]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 103250348 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[(3,3,3-trifluoropropylamino)methyl]-1-benzofuran-3-carboxylic acid |
| SMILES | O=C(O)c1c(CNCCC(F)(F)F)oc2ccccc12 |
| InChI | InChI=1S/C13H12F3NO3/c14-13(15,16)5-6-17-7-10-11(12(18)19)8-3-1-2-4-9(8)20-10/h1-4,17H,5-7H2,(H,18,19) |
| InChIKey | OEBJCMKIVXBVKR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|