C14H15FN2O3 — CID 103257001
5-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 103257001) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 103257001 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | Cc1cc(F)ccc1CCNCc1cc(C(=O)O)no1 |
| InChI | InChI=1S/C14H15FN2O3/c1-9-6-11(15)3-2-10(9)4-5-16-8-12-7-13(14(18)19)17-20-12/h2-3,6-7,16H,4-5,8H2,1H3,(H,18,19) |
| InChIKey | CPVNDJTXIYZJKN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|