C10H14N4O3 — CID 106904907
6-[[2-(carbamoylamino)ethylamino]methyl]pyridine-2-carboxylic acid (PubChem CID 106904907) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-[[2-(carbamoylamino)ethylamino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[2-(carbamoylamino)ethylamino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106904907 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-[[2-(carbamoylamino)ethylamino]methyl]pyridine-2-carboxylic acid |
| SMILES | NC(=O)NCCNCc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C10H14N4O3/c11-10(17)13-5-4-12-6-7-2-1-3-8(14-7)9(15)16/h1-3,12H,4-6H2,(H,15,16)(H3,11,13,17) |
| InChIKey | JPTYSQCDLQSMJQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|