C12H22N2O2 — CID 166148097
ethane;6-(methylaminomethyl)pyridine-2-carboxylic acid (PubChem CID 166148097) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;6-(methylaminomethyl)pyridine-2-carboxylic acid.
| Compound Name | ethane;6-(methylaminomethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166148097 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethane;6-(methylaminomethyl)pyridine-2-carboxylic acid |
| SMILES | CC.CC.CNCc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C8H10N2O2.2C2H6/c1-9-5-6-3-2-4-7(10-6)8(11)12;2*1-2/h2-4,9H,5H2,1H3,(H,11,12);2*1-2H3 |
| InChIKey | MPQDVSDVQYYESR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |